|
|
| | 2-(4-FLUOROPHENYL)BENZOXAZOLE Basic information |
| Product Name: | 2-(4-FLUOROPHENYL)BENZOXAZOLE | | Synonyms: | Benzoxazole, 2-(4-fluorophenyl)-Benzoxazole, 2-(p-fluorophenyl)- (7CI,8CI);2-(4-FLUORO-PHENYL)-BENZOOXAZOLE;2-(4-FLUOROPHENYL)BENZOXAZOLE;Benzoxazole, 2-(4-fluorophenyl)-;2-(4-fluorophenyl)benzo[d]oxazole;2-(4-Fluorophenyl)benzo[d]oxazole, No.: | | CAS: | 397-54-6 | | MF: | C13H8FNO | | MW: | 213.21 | | EINECS: | | | Product Categories: | | | Mol File: | 397-54-6.mol |  |
| | 2-(4-FLUOROPHENYL)BENZOXAZOLE Chemical Properties |
| Melting point | 92-95 °C(Solv: hexane (110-54-3)) | | Boiling point | 291.1±23.0 °C(Predicted) | | density | 1.261±0.06 g/cm3(Predicted) | | pka | 1.03±0.10(Predicted) | | InChI | InChI=1S/C13H8FNO/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13/h1-8H | | InChIKey | KETHPFOJWJUQFI-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC=C2N=C1C1=CC=C(F)C=C1 |
| | 2-(4-FLUOROPHENYL)BENZOXAZOLE Usage And Synthesis |
| | 2-(4-FLUOROPHENYL)BENZOXAZOLE Preparation Products And Raw materials |
|