5-BROMO-1H-QUINOLIN-2-ONE manufacturers
|
| | 5-BROMO-1H-QUINOLIN-2-ONE Basic information |
| Product Name: | 5-BROMO-1H-QUINOLIN-2-ONE | | Synonyms: | 5-BROMO-1H-QUINOLIN-2-ONE;5-Bromoquinolin-2(1H)-on;5-Bromo-2-hydroxyquinoline;2(1H)-Quinolinone, 5-bromo-;5-bromoquinolin-2-ol;5-Bromo-2(1H)-quinolinone 97%min;5-bromoquinoline-2(1H)-one;5-BROMOQUINOLIN-2(1H)-ONE | | CAS: | 99465-09-5 | | MF: | C9H6BrNO | | MW: | 224.05 | | EINECS: | | | Product Categories: | | | Mol File: | 99465-09-5.mol |  |
| | 5-BROMO-1H-QUINOLIN-2-ONE Chemical Properties |
| Boiling point | 389.6±42.0 °C(Predicted) | | density | 1.620±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 10.89±0.70(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C9H6BrNO/c10-7-2-1-3-8-6(7)4-5-9(12)11-8/h1-5H,(H,11,12) | | InChIKey | XLNXYWXWOLFEOD-UHFFFAOYSA-N | | SMILES | N1C2=C(C(Br)=CC=C2)C=CC1=O |
| | 5-BROMO-1H-QUINOLIN-2-ONE Usage And Synthesis |
| | 5-BROMO-1H-QUINOLIN-2-ONE Preparation Products And Raw materials |
|