| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 9,9-Dimethyl-2-nitrofluorene Basic information |
| Product Name: | 9,9-Dimethyl-2-nitrofluorene | | Synonyms: | 2-Nitro-9,9-diMethylfluorene,9,9-diMethyl-2-nitrofluorene;9,9-Dimethyl-2-nitrofluorene 9,9-Dimethyl-2-nitro-9H-fluorene;9,9-Dimethyl-2-nitrofluorene, 99.5%;9H-Fluorene, 9,9-dimethyl-2-nitro-;9,9-Dimethyl-2-nitrofluorene >9,9-Dimethyl-2-nitrofluorene;2-Nitro-9,9-dimethylfluorene;9,9-Dimethyl-2-nitro-9H-fluorene | | CAS: | 605644-46-0 | | MF: | C15H13NO2 | | MW: | 239.27 | | EINECS: | 1533716-785-6 | | Product Categories: | Fluorene Series | | Mol File: | 605644-46-0.mol |  |
| | 9,9-Dimethyl-2-nitrofluorene Chemical Properties |
| Melting point | 101.0 to 105.0 °C | | Boiling point | 373.1±21.0 °C(Predicted) | | density | 1.204 | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Off-white to light yellow Solid | | λmax | 336nm(CHCl3)(lit.) | | InChI | InChI=1S/C15H13NO2/c1-15(2)13-6-4-3-5-11(13)12-8-7-10(16(17)18)9-14(12)15/h3-9H,1-2H3 | | InChIKey | SPNVINZCDHRVAI-UHFFFAOYSA-N | | SMILES | C1(C)(C)C2=C(C=CC=C2)C2=C1C=C([N+]([O-])=O)C=C2 |
| | 9,9-Dimethyl-2-nitrofluorene Usage And Synthesis |
| Chemical Properties | Oyster solid |
| | 9,9-Dimethyl-2-nitrofluorene Preparation Products And Raw materials |
|