| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:1,4-di-tert-butyl-2,5-bis(2,2,2-trifluoroethoxy)benzene CAS:1147737-68-5 Purity:97% Package:1g;10g;100g;1KG;5KG
|
|
| | 1,4-di-tert-butyl-2,5-bis(2,2,2-trifluoroethoxy)benzene Basic information |
| Product Name: | 1,4-di-tert-butyl-2,5-bis(2,2,2-trifluoroethoxy)benzene | | Synonyms: | 1,4-di-tert-butyl-2,5-bis(2,2,2-trifluoroethoxy)benzene;1,4-di-tert-butyl-2,5-bis(2,2,2-trifluoro;Benzene, 1,4-bis(1,1-dimethylethyl)-2,5-bis(2,2,2-trifluoroethoxy)-;1,4-di-tert-butyl-2,5-bis(2,2,2-trifluoroethoxy)benzene - [AC77601] | | CAS: | 1147737-68-5 | | MF: | C18H24F6O2 | | MW: | 386.37 | | EINECS: | | | Product Categories: | | | Mol File: | 1147737-68-5.mol |  |
| | 1,4-di-tert-butyl-2,5-bis(2,2,2-trifluoroethoxy)benzene Chemical Properties |
| Boiling point | 353.8±42.0 °C(Predicted) | | density | 1.147±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C18H24F6O2/c1-15(2,3)11-7-14(26-10-18(22,23)24)12(16(4,5)6)8-13(11)25-9-17(19,20)21/h7-8H,9-10H2,1-6H3 | | InChIKey | WVKLDBVAQACGSR-UHFFFAOYSA-N | | SMILES | C1(C(C)(C)C)=CC(OCC(F)(F)F)=C(C(C)(C)C)C=C1OCC(F)(F)F |
| | 1,4-di-tert-butyl-2,5-bis(2,2,2-trifluoroethoxy)benzene Usage And Synthesis |
| Chemical Properties | 1,4-di-tert-butyl-2,5-bis(2,2,2-trifluoroethoxy)benzene Appearance is white or light yellow powder or solid, Density: 1.147±0.06 g/cm3, Boiling point: 353.8±42.0°C, stored at room temperature. | | Uses | 1,4-di-tert-butyl-2,5-bis(2,2,2-trifluoroethoxy)benzene is a fluorine-containing aromatic organic compound that has the potential to enhance the efficiency of organic solar cells as an additive ingredient that reduces charge carrier recombination while imparting excellent electron mobility. In addition, it has the ability to self-assemble nanostructures, making it a potential candidate for drug delivery systems. |
| | 1,4-di-tert-butyl-2,5-bis(2,2,2-trifluoroethoxy)benzene Preparation Products And Raw materials |
|