Fluoxetine Succinamic Acid manufacturers
|
| | Fluoxetine Succinamic Acid Basic information |
| | Fluoxetine Succinamic Acid Chemical Properties |
| Melting point | 113 - 115°C | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Acetonitrile (Slightly), Methanol (Slightly) | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C21H22F3NO4/c1-25(19(26)11-12-20(27)28)14-13-18(15-5-3-2-4-6-15)29-17-9-7-16(8-10-17)21(22,23)24/h2-10,18H,11-14H2,1H3,(H,27,28) | | InChIKey | SAIPSZMZTANCFE-UHFFFAOYSA-N | | SMILES | CN(CCC(Oc1ccc(cc1)C(F)(F)F)c2ccccc2)C(=O)CCC(O)=O |
| RIDADR | UN 3077 9 / PGIII | | WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | Fluoxetine Succinamic Acid Usage And Synthesis |
| Uses | A related compound of Fluoxetine (F597100). Fluoxetine USP Related Compound C. |
| | Fluoxetine Succinamic Acid Preparation Products And Raw materials |
|