3,4-Difluoro-2-methoxyphenylboronic acid manufacturers
|
| | 3,4-Difluoro-2-methoxyphenylboronic acid Basic information |
| Product Name: | 3,4-Difluoro-2-methoxyphenylboronic acid | | Synonyms: | 3,4-Difluoro-2-methoxyphenylboronic acid;3,4-difluoro-2-methoxybenzeneboronic acid;Boronic acid, B-(3,4-difluoro-2-methoxyphenyl)-;B-(3,4-Difluoro-2-methoxyphenyl)boronic acid | | CAS: | 905583-06-4 | | MF: | C7H7BF2O3 | | MW: | 187.94 | | EINECS: | 218-362-5 | | Product Categories: | | | Mol File: | 905583-06-4.mol |  |
| | 3,4-Difluoro-2-methoxyphenylboronic acid Chemical Properties |
| Boiling point | 308.0±52.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | pka | 7.61±0.58(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C7H7BF2O3/c1-13-7-4(8(11)12)2-3-5(9)6(7)10/h2-3,11-12H,1H3 | | InChIKey | VSALEQTUDXMKST-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(F)C(F)=C1OC)(O)O |
| | 3,4-Difluoro-2-methoxyphenylboronic acid Usage And Synthesis |
| | 3,4-Difluoro-2-methoxyphenylboronic acid Preparation Products And Raw materials |
|