N1-[(1S)-2,2-Dimethyl-1-[[[(1R)-1-phenylethyl]amino]carbonyl]propyl]-N4-hydroxy-2-[3-(2-methyl[1,1'-biphenyl]-4-yl)propyl]-butanediamine manufacturers
- UK 356618
-
- $2260.00
-
2026-09-12
- CAS:230961-08-7
- Purity:
- Supply Ability: 10g
- UK-356618
-
-
2026-07-01
- CAS:230961-08-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kg
|
| | N1-[(1S)-2,2-Dimethyl-1-[[[(1R)-1-phenylethyl]amino]carbonyl]propyl]-N4-hydroxy-2-[3-(2-methyl[1,1'-biphenyl]-4-yl)propyl]-butanediamine Basic information |
| Product Name: | N1-[(1S)-2,2-Dimethyl-1-[[[(1R)-1-phenylethyl]amino]carbonyl]propyl]-N4-hydroxy-2-[3-(2-methyl[1,1'-biphenyl]-4-yl)propyl]-butanediamine | | Synonyms: | N1-[(1S)-2,2-Dimethyl-1-[[[(1R)-1-phenylethyl]amino]carbonyl]propyl]-N4-hydroxy-2-[3-(2-methyl[1,1'-biphenyl]-4-yl)propyl]-butanediamine;UK 356618;(2R)-N1-[(1S)-2,2-DiMethyl-1-[[[(1R)-1-phenylethyl]aMino]carbonyl]propyl]-N4-hydroxy-2-[3-(2-Methyl[1,1'-biphenyl]-4-yl)propyl]butanediaMide;PF-03890101;(2R)-N1-[(1S)-2,2-Dimethyl-1-({[(1R)-1-phenylethyl]amino}carbonyl)propyl]-2-{3-[(3-methyl-4-phenyl)-phenyl]propyl}-(N4-hydroxy)butanediamide;UK 356618 - PF 03890101;Butanediamide, N1-[(1S)-2,2-dimethyl-1-[[[(1R)-1-phenylethyl]amino]carbonyl]propyl]-N4-hydroxy-2-[3-(2-methyl[1,1'-biphenyl]-4-yl)propyl]-, (2R)- | | CAS: | 230961-08-7 | | MF: | C34H43N3O4 | | MW: | 557.72 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Inhibitors;Intermediates & Fine Chemicals;Pfizer Compounds;Pharmaceuticals | | Mol File: | 230961-08-7.mol | ![N1-[(1S)-2,2-Dimethyl-1-[[[(1R)-1-phenylethyl]amino]carbonyl]propyl]-N4-hydroxy-2-[3-(2-methyl[1,1'-biphenyl]-4-yl)propyl]-butanediamine Structure](CAS/20210111/GIF/230961-08-7.gif) |
| | N1-[(1S)-2,2-Dimethyl-1-[[[(1R)-1-phenylethyl]amino]carbonyl]propyl]-N4-hydroxy-2-[3-(2-methyl[1,1'-biphenyl]-4-yl)propyl]-butanediamine Chemical Properties |
| Melting point | 93-102oC | | density | 1.124±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: ≥25mg/mL | | form | powder | | pka | 9.16±0.20(Predicted) | | color | white to tan | | Optical Rotation | [α]/D >+25.0°, c = 0.5 in methanol | | InChIKey | JJHRUUKMPWUYIB-HVOSOHGQSA-N | | SMILES | C[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CCCc1ccc(c(C)c1)-c2ccccc2)CC(=O)NO)C(C)(C)C)c3ccccc3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N1-[(1S)-2,2-Dimethyl-1-[[[(1R)-1-phenylethyl]amino]carbonyl]propyl]-N4-hydroxy-2-[3-(2-methyl[1,1'-biphenyl]-4-yl)propyl]-butanediamine Usage And Synthesis |
| Uses | Potent and selective inhibitor of matrix metalloprotease-3 (MMP-3) (IC50 = 5.9 nM). Displays selectivity over a range of MMPs (IC50 values are 73, 840, 1790, 1900 and 51000 for MMP-13, MMP-9, MMP-2, MMP-14 and MMP-1 respectively). | | Definition | ChEBI: (2R)-N-[(2S)-3,3-dimethyl-1-oxo-1-[[(1R)-1-phenylethyl]amino]butan-2-yl]-N'-hydroxy-2-[3-(3-methyl-4-phenylphenyl)propyl]butanediamide is a secondary carboxamide. | | Biological Activity | UK 356618 has the potential to inhibit interleukin (IL)-6-induced cell migration in NCI H446 small cell lung cancer cells in vitro.', 'UK-356,618 is a potent, selective inhibitor of Matrix metalloproteinase MMP3 (stromelysin-1). MMP-3 IC50 = 5.9 nM, selectivity is 140-fold vs MMP-1, -2, -9, and -14. | | in vivo | UK 356618 (15 mg/kg; intravenous injection; for 24 h or 7 days; male Wistar rats) treatment at reperfusion significantly reduces MMP3 activity in the brain[3]. | Animal Model: | Hyperglycemic male Wistar rats injected with middle cerebral artery occlusion (MCAO)[3] | | Dosage: | 15 mg/kg | | Administration: | Intravenous injection; for 24 h or 7 days | | Result: | Significantly reduced MMP3 activity in the brain.
|
| | IC 50 | MMP-3: 5.9 nM (IC50); MMP-13: 73 nM (IC50); MMP-9: 0.84 μM (IC50); MMP-2: 1.79 μM (IC50); MMP-14: 1.9 μM (IC50); MMP-1: 51 μM (IC50) |
| | N1-[(1S)-2,2-Dimethyl-1-[[[(1R)-1-phenylethyl]amino]carbonyl]propyl]-N4-hydroxy-2-[3-(2-methyl[1,1'-biphenyl]-4-yl)propyl]-butanediamine Preparation Products And Raw materials |
|