|
|
| | 5-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-oxazole Basic information |
| Product Name: | 5-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-oxazole | | Synonyms: | 5-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-oxazole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole;5-(4,4,5,5-tetramethyl-1,3,2,-dioxaboralan-2-yl)oxazole;Oxazole, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;Oxazole-5-boronic Acid Pinacol Ester | | CAS: | 942070-84-0 | | MF: | C9H14BNO3 | | MW: | 195.02 | | EINECS: | | | Product Categories: | | | Mol File: | 942070-84-0.mol | ![5-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-oxazole Structure](CAS/GIF/942070-84-0.gif) |
| | 5-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-oxazole Chemical Properties |
| Boiling point | 276.7±13.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 0.58±0.10(Predicted) | | InChI | InChI=1S/C9H14BNO3/c1-8(2)9(3,4)14-10(13-8)7-5-11-6-12-7/h5-6H,1-4H3 | | InChIKey | VKDRZPADYMLKNW-UHFFFAOYSA-N | | SMILES | O1C(B2OC(C)(C)C(C)(C)O2)=CN=C1 |
| | 5-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-oxazole Usage And Synthesis |
| Uses | 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole is a reagent used in the preparation of checkpoint kinase I (Chk1) inhibitors, used in the treatment of DNA damage and facilitating cell-cycle arrest. |
| | 5-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-oxazole Preparation Products And Raw materials |
|