| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(+)-alpha-Longipinene
CAS:5989-08-2
Purity:>=99.0% (sum of enantiomers, GC) Package:250MG Remarks:62638-250MG-F
|
| Company Name: |
UHN Shanghai Research & Development Co., Ltd.
|
| Tel: |
021-58958002 18930822973 |
| Email: |
sales@uhnshanghai.com |
| Products Intro: |
Product Name:(+)-ALPHA-LONGIPINENE
CAS:5989-08-2
Purity:98% LCMS Package:10g, 50g, 100g, 1Kg
|
|
| | (+)-ALPHA-LONGIPINENE Basic information |
| Product Name: | (+)-ALPHA-LONGIPINENE | | Synonyms: | Tricyclo[5.4.0.0(2,8)]undec-9-ene, 2,6,6,9-tetramethyl-;Tricyclo[5.4.0.0(2,8)]undec-9-ene, 3,3,7,9-tetramethyl-;(+)-alpha-Longipinene >=99.0% (sum of enantiomers, GC);(1R,2S,7R,8R)-2,6,6,9-TETRAMETHYL-TRICYCLO[5.4.0.0(2.8)]UNDEC-9-ENE;(+)-ALPHA-LONGIPINENE;(+)-α-longipinene;2,6,6,9-Tetramethyl-tricyclo[5.4.0.0(2,8)]undec-9-ene;(+)-alfa-Longipinene | | CAS: | 5989-08-2 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | | | Product Categories: | | | Mol File: | 5989-08-2.mol |  |
| | (+)-ALPHA-LONGIPINENE Chemical Properties |
| Boiling point | 244-246 °C(lit.) | | density | 0.915 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.493 | | Fp | 92℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Optical Rotation | [α]20/D +25±1°, neat | | Henry's Law Constant | 3.4×10-4 mol/(m3Pa) at 25℃, Copolovici and Niinemets (2015) | | Stability: | Light Sensitive | | InChI | 1S/C15H24/c1-10-6-7-11-13-12(10)15(11,4)9-5-8-14(13,2)3/h6,11-13H,5,7-9H2,1-4H3/t11-,12+,13+,15-/m1/s1 | | InChIKey | HICYDYJTCDBHMZ-UKTARXLSSA-N | | SMILES | [H][C@@]12CC=C(C)[C@@]3([H])[C@@]1([H])C(C)(C)CCC[C@]23C | | LogP | 6.398 (est) |
| Safety Statements | 23-24/25 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | (+)-ALPHA-LONGIPINENE Usage And Synthesis |
| Uses | (+)-α-Longipinene can be used as a starting material for the synthesis of new terpenoids, (+)-(5S)-5,12-dihydroxy-α-longipinene, (-)-(5R)-5,12-dihydroxy-α-longipinene, and (+)-12-hydroxy-α-longipinen-5-one by oxidation reaction using Aspergillus niger as a biocatalyst. It can be oxidized using lead tetraacetate into tertiary alcohol, longi-cis-verbenol, longi-trans-verbenol, longi-cis-β-crysanthenol, longiverbenone, longi-trans- β -crysanthenol, 2 β,3 β -dihydroxylongipinane, 4 α,8-dihydroxy- α -Iongipinene, and 4 β,8-dihydroxy- α -longipinene. | | Definition | ChEBI: A bridged compound and sesquiterpene that is tricyclo[5.4.0.02,8]undecane that is substituted by methyl groups at the 2, 6, 6, and 9 positions and has a double bond between positions 9 and 10. |
| | (+)-ALPHA-LONGIPINENE Preparation Products And Raw materials |
|