|
|
| | Triethyl 1,1,2-ethanetricarboxylate Basic information |
| Product Name: | Triethyl 1,1,2-ethanetricarboxylate | | Synonyms: | 1,1,2-Tricarbethoxyethane;Ethane-1,1,2-tricarboxylic acid, triethyl ester;Triethyl ethane tricarboxylate;Triethyl 1,1,2-ethanetricarboxylate 99%;Triethyl1,1,2-ethanetricarboxylate/triethylethane-1,1,2-tricarboxylate;Triethyle1, 1, 2-ethanetricarboxylate;1,1,2-triethyl ethane-1,1,2-tricarboxylate;Triethyl ethane-1,2,2-tricarboxylate | | CAS: | 7459-46-3 | | MF: | C11H18O6 | | MW: | 246.26 | | EINECS: | 231-235-9 | | Product Categories: | Building Blocks;C10 to C11;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;C10 to C11;Carbonyl Compounds;Esters | | Mol File: | 7459-46-3.mol |  |
| | Triethyl 1,1,2-ethanetricarboxylate Chemical Properties |
| Boiling point | 99 °C/0.5 mmHg (lit.) | | density | 1.074 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.429(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Ethyl Acetate | | pka | 11.78±0.59(Predicted) | | form | Liquid | | color | Clear colorless | | Specific Gravity | 1.074 | | BRN | 1796294 | | Dielectric constant | 6.5(19.0℃) | | InChI | InChI=1S/C11H18O6/c1-4-15-9(12)7-8(10(13)16-5-2)11(14)17-6-3/h8H,4-7H2,1-3H3 | | InChIKey | TVWZLLYAJDSSCJ-UHFFFAOYSA-N | | SMILES | C(C(=O)OCC)(C(=O)OCC)CC(=O)OCC | | CAS DataBase Reference | 7459-46-3(CAS DataBase Reference) | | NIST Chemistry Reference | 1,1,2-Ethanetricarboxylic acid, triethyl ester(7459-46-3) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | HS Code | 29420000 | | Storage Class | 10 - Combustible liquids |
| | Triethyl 1,1,2-ethanetricarboxylate Usage And Synthesis |
| Description | Triethyl 1,1,2-ethanetricarboxylate is a carboxylic acid ester compound that can be used in nanomaterials, pharmaceutical intermediates, organic synthesis and other fields. | | Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 1,1,2-Ethanetricarboxylic Acid 1,1,2-Triethyl Ester is a useful synthetic intermediate. It can be used to prepare Isobutylsuccinic Acid (I780660) which was used to synthesize succinimide derivatives as inhibitors of human leukocyte elastase, cathepsin G and proteinase 3. | | Synthesis | Step a): Sodium metal (23 g, 1 mole) was slowly added to anhydrous ethanol (500 mL) under stirring conditions until completely dissolved. Subsequently, diethyl malonate (160 g, 1 mole) was added dropwise over 30 min. After cooling the reaction mixture to 15°C, ethyl chloroacetate (117 g, 0.095 mol) was added dropwise over the same time. After the dropwise addition, the reaction mixture was refluxed for 6 hours. After completion of the reaction, the mixture was poured into 2 liters of water and the organic phase was extracted with dichloromethane (500 mL each time, three times). The organic extracts were combined, dried with anhydrous sodium sulfate, filtered and the solvent was evaporated to give an oily crude product. Finally, purification by vacuum distillation afforded triethyl ethyl-1,1,2-tricarboxylate (220 g, 89% yield). | | References | [1] Patent: WO2013/29767, 2013, A1. Location in patent: Page/Page column 16; 17 [2] Patent: CN105566111, 2016, A. Location in patent: Paragraph 0029-30 [3] Liebigs Annalen der Chemie, 1983, # 1, p. 112 - 136 [4] Patent: WO2012/92880, 2012, A1. Location in patent: Page/Page column 45-46 [5] Justus Liebigs Annalen der Chemie, 1882, vol. 214, p. 38 |
| | Triethyl 1,1,2-ethanetricarboxylate Preparation Products And Raw materials |
|