| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3'-BroMo-5'-(trifluoroMethyl)acetophenone, 97% Basic information |
| Product Name: | 3'-BroMo-5'-(trifluoroMethyl)acetophenone, 97% | | Synonyms: | 3'-BroMo-5'-(trifluoroMethyl)acetophenone, 97%;Ethanone, 1-[3-bromo-5-(trifluoromethyl)phenyl]-;3'-Bromo-5'-(trifluoromethyl)acetophenone,97%;3'-Bromo-5'-(trifluoromethyl)acetophenone;1-(3-bromo-5-(trifluoromethyl)phenyl)ethan-1-one | | CAS: | 154259-25-3 | | MF: | C9H6BrF3O | | MW: | 267.04 | | EINECS: | | | Product Categories: | | | Mol File: | 154259-25-3.mol |  |
| | 3'-BroMo-5'-(trifluoroMethyl)acetophenone, 97% Chemical Properties |
| Melting point | <25℃ | | refractive index | 1.5045 | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to yellow Solid-liquid mixture | | InChI | InChI=1S/C9H6BrF3O/c1-5(14)6-2-7(9(11,12)13)4-8(10)3-6/h2-4H,1H3 | | InChIKey | BVCLQCAMSFVBFX-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(C(F)(F)F)=CC(Br)=C1)C |
| | 3'-BroMo-5'-(trifluoroMethyl)acetophenone, 97% Usage And Synthesis |
| Uses | 3''-Bromo-5’-(trifluoromethyl)acetophenone is used as a reactant in the preparation of 2-aminothiazole derivatives as muscarinic M3 receptor positive allosteric modulators. |
| | 3'-BroMo-5'-(trifluoroMethyl)acetophenone, 97% Preparation Products And Raw materials |
|