|
|
| | HeMatoporphyrin MonoMethyl ether Basic information |
| Product Name: | HeMatoporphyrin MonoMethyl ether | | Synonyms: | HeMatoporphyrin MonoMethyl ether;8-(1-Hydroxyethyl)-13-(1-methoxyethyl)-3,7,12,17-tetramethyl-21H,23H-porphine-2,18-dipropanoic acid;HeMatoporphyrin MonoMethyl Ether,HMME;21H,23H-Porphine-2,18-dipropanoic acid, 8-(1-hydroxyethyl)-13-(1-methoxyethyl)-3,7,12,17-tetramethyl-;3-(1-Hydroxyethyl)-8-(1-methoxyethyl)deuteroporphyrin;3HEDP;HMME | | CAS: | 148471-91-4 | | MF: | C35H40N4O6 | | MW: | 612.72 | | EINECS: | | | Product Categories: | | | Mol File: | 148471-91-4.mol |  |
| | HeMatoporphyrin MonoMethyl ether Chemical Properties |
| Boiling point | 1123.6±65.0 °C(Predicted) | | density | 1.287 | | storage temp. | 4°C, protect from light | | solubility | DMSO : 62.5 mg/mL (102.00 mM; Need ultrasonic) | | form | Solid | | color | Brown to reddish brown | | InChIKey | HWEFINLVIQZVMZ-OYYVZGGRSA-N | | SMILES | C1=C2N=C(C=C3NC(=CC4=NC(=CC5NC1=C(C)C=5CCC(O)=O)C(CCC(O)=O)=C4C)C(C(OC)C)=C3C)C(C(O)C)=C2C |c:0,4,7,11| |
| | HeMatoporphyrin MonoMethyl ether Usage And Synthesis |
| Uses | Hematoporphyrin monomethyl ether, second generation of porphyrin-related photosensitizer, is characterized by its single form, high yield of singlet oxygen, high selectivity, and low toxicity, which has been widely used in the diagnosis and research of various tumors, including lung cancer, bladder cancer, and nevus flammeus and brain glioma[1]. | | References | [1] Ding X, et al. Hematoporphyrin monomethyl ether photodynamic damage on HeLa cells by means of reactive oxygen species production and cytosolic free calcium concentration elevation. Cancer Lett. 2004;216(1):43-54. DOI:10.1016/j.canlet.2004.07.005 |
| | HeMatoporphyrin MonoMethyl ether Preparation Products And Raw materials |
|