|
|
| | 1H-Indazole-6-carboxylic acid, 5-broMo-, Methyl ester Basic information | | Application |
| | 1H-Indazole-6-carboxylic acid, 5-broMo-, Methyl ester Chemical Properties |
| Boiling point | 391.9±22.0 °C(Predicted) | | density | 1.709±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 11.17±0.40(Predicted) | | form | solid | | color | Faint yellow | | InChI | InChI=1S/C9H7BrN2O2/c1-14-9(13)6-3-8-5(2-7(6)10)4-11-12-8/h2-4H,1H3,(H,11,12) | | InChIKey | OMGXGABLIDYSNN-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Br)C(C(OC)=O)=C2)C=N1 |
| WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | 1H-Indazole-6-carboxylic acid, 5-broMo-, Methyl ester Usage And Synthesis |
| Application | 5-Bromo-1H-indazole-6-carboxylic acid methyl ester can be used as a pharmaceutical synthesis intermediate. If 5-Bromo-1H-indazole-6-carboxylic acid methyl ester is inhaled, move the patient to fresh air; if skin contact occurs, remove contaminated clothing, thoroughly wash skin with soap and water, and seek medical attention if discomfort persists. |
| | 1H-Indazole-6-carboxylic acid, 5-broMo-, Methyl ester Preparation Products And Raw materials |
|