| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl 5-bromo-1H-indazole-3-carboxylate Basic information |
| Product Name: | Methyl 5-bromo-1H-indazole-3-carboxylate | | Synonyms: | 5-Bromo-3-(methoxycarbonyl)-1H-indazole;5-Bromo-1H-indazole-3-carboxylic acid methyl ester;1H-Indazole-3-carboxylicacid,5-broMo-,Methylester;Methyl 5-bromo-1H-indazol...;Methyl 5-bromo-1H-indazole-3-carboxylate | | CAS: | 78155-74-5 | | MF: | C9H7BrN2O2 | | MW: | 255.07 | | EINECS: | | | Product Categories: | | | Mol File: | 78155-74-5.mol |  |
| | Methyl 5-bromo-1H-indazole-3-carboxylate Chemical Properties |
| Melting point | 208-210℃ | | Boiling point | 399.7±22.0 °C(Predicted) | | density | 1.709 | | storage temp. | 2-8°C | | pka | 10.67±0.40(Predicted) | | Appearance | off-white solid | | InChI | InChI=1S/C9H7BrN2O2/c1-14-9(13)8-6-4-5(10)2-3-7(6)11-12-8/h2-4H,1H3,(H,11,12) | | InChIKey | WVNKCZKRGOOMNU-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Br)C=C2)C(C(OC)=O)=N1 |
| | Methyl 5-bromo-1H-indazole-3-carboxylate Usage And Synthesis |
| Uses | Methyl 5-bromo-1H-indazole-3-carboxylate is an indole azole compound containing a five-membered heteroaromatic ring structure and can be used in organic synthesis. Its derivatives can also be used to treat or prevent herpes virus infection in patients. | | Synthesis | Step 2: Concentrated sulfuric acid (1 mL) was slowly added to a suspension of 5-bromo-1H-indazole-3-carboxylic acid (1.30 g, 5.39 mmol) in anhydrous methanol (50 mL) under argon protection. The reaction mixture was heated to reflux for 4 hours. Upon completion of the reaction, the solution was cooled to room temperature and subsequently evaporated under reduced pressure to remove methanol. The residue was dissolved in ethyl acetate and washed with deionized water. The organic phase was dried over anhydrous sodium sulfate, filtered and concentrated to afford methyl 5-bromo-1H-indazole-3-carboxylate (1.35 g, 5.29 mmol, 98% yield) as a white solid. The product was confirmed by 1H NMR (DMSO-d6): δ 14.13 (s, 1H), 8.21 (d, J = 1.6 Hz, 1H), 7.67 (d, J = 7.2 Hz, 1H), 7.59 (dd, J = 7.2, 1.2 Hz, 1H), 3.92 (s, 3H); ESIMS analysis result: C9H7BrN2O2 m/z 256.0 (M + H). | | References | [1] Patent: WO2013/40215, 2013, A1. Location in patent: Paragraph 00340 [2] Patent: US2015/266825, 2015, A1. Location in patent: Paragraph 1359; 1361 [3] Patent: WO2018/75858, 2018, A1. Location in patent: Paragraph 0371; 0373 [4] European Journal of Organic Chemistry, 2007, # 29, p. 4909 - 4916 [5] Patent: CN107573327, 2018, A. Location in patent: Paragraph 0071; 0072; 0073; 0074 |
| | Methyl 5-bromo-1H-indazole-3-carboxylate Preparation Products And Raw materials |
|