|
|
| | Zolpidem-D6 (Not suitable for use with GC/MS) Basic information |
| Product Name: | Zolpidem-D6 (Not suitable for use with GC/MS) | | Synonyms: | D6-zolpidem;2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-bis(trideuteriomethyl)acetamide;Zolpidem-D6 (Not suitable for use with GC/MS);Zolpidem-D6 solution;Zolpidem D6 (controlled);Zolpidem-d6 (CRM);Zolpidem-d6 (N-dimethyl-d6);Zolpidem D6Q: What is
Zolpidem D6 Q: What is the CAS Number of
Zolpidem D6 Q: What is the storage condition of
Zolpidem D6 Q: What are the applications of
Zolpidem D6 | | CAS: | 959605-90-4 | | MF: | C19H21N3O | | MW: | 307.4 | | EINECS: | 200-659-6 | | Product Categories: | | | Mol File: | 959605-90-4.mol |  |
| | Zolpidem-D6 (Not suitable for use with GC/MS) Chemical Properties |
| Fp | 9℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Possibly Shock Sensitive | | InChI | InChI=1S/C19H21N3O/c1-13-5-8-15(9-6-13)19-16(11-18(23)21(3)4)22-12-14(2)7-10-17(22)20-19/h5-10,12H,11H2,1-4H3 | | InChIKey | ZAFYATHCZYHLPB-UHFFFAOYSA-N | | SMILES | C(C1N2C=C(C)C=CC2=NC=1C1C=CC(C)=CC=1)C(=O)N(C([H])([H])[H])C([H])([H])[H] |
| | Zolpidem-D6 (Not suitable for use with GC/MS) Usage And Synthesis |
| Uses | Deuterated Zolpidem, a selective non-benzodiazepine GABAA receptor agonist. Sedative, hypnotic. Controlled substance (depresssant). |
| | Zolpidem-D6 (Not suitable for use with GC/MS) Preparation Products And Raw materials |
|