| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Boc-Phe-(R)-Phe-OH Basic information |
| Product Name: | Boc-Phe-(R)-Phe-OH | | Synonyms: | BOC-PHE-PSI(CH2NH)-PHE-OH;BOC-PHE-Y(CH2NH)-PHE-OH;RARECHEM EM WB 0264;Boc-Phe-ψ(CH2NH)-Phe-OH;((S)-2-((tert-butoxycarbonyl)amino)-3-phenylpropyl)-L-phenylalanine;L-Phenylalanine, N-[2-[[(1,1-dimethylethoxy)carbonyl]amino]-3-phenylpropyl]-, (S)- (9CI);Boc-Phe-(R)-Phe-OH | | CAS: | 114290-82-3 | | MF: | C23H30N2O4 | | MW: | 398.5 | | EINECS: | | | Product Categories: | | | Mol File: | 114290-82-3.mol |  |
| | Boc-Phe-(R)-Phe-OH Chemical Properties |
| Boiling point | 589.0±50.0 °C(Predicted) | | density | 1.144±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | pka | 2.17±0.10(Predicted) |
| | Boc-Phe-(R)-Phe-OH Usage And Synthesis |
| | Boc-Phe-(R)-Phe-OH Preparation Products And Raw materials |
|