|
|
| | 6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one Basic information |
| Product Name: | 6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one | | Synonyms: | 6-bromospiro[1H-indole-3,4'-oxane]-2-one;Spiro[3H-indole-3,4'-[4H]pyran]-2(1H)-one, 6-bromo-2',3',5',6'-tetrahydro-;6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one;6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one;6-Bromo-1H-spiro[indole-3,4'-oxane]-2-one | | CAS: | 1190861-43-8 | | MF: | C12H12BrNO2 | | MW: | 282.13 | | EINECS: | | | Product Categories: | | | Mol File: | 1190861-43-8.mol | ![6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one Structure](CAS/GIF/1190861-43-8.gif) |
| | 6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one Chemical Properties |
| Boiling point | 437.1±45.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.70±0.20(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C12H12BrNO2/c13-8-1-2-9-10(7-8)14-11(15)12(9)3-5-16-6-4-12/h1-2,7H,3-6H2,(H,14,15) | | InChIKey | WGDOZEMHDIATQE-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(Br)=C2)C2(CCOCC2)C1=O |
| | 6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one Usage And Synthesis |
| Synthesis | Tert-butyl 6-bromo-2-oxo-2',3',5',6'-tetrahydrospiro[dihydroindole-3,4'-pyran]-1-carboxylate (4.20 g, 11.0 mmol) was used as a starting material, which was dissolved in 1,4-dioxane (25 mL), and 5 M hydrogen chloride solution was added. The reaction mixture was stirred at room temperature for 5 hours. Upon completion of the reaction, the mixture was concentrated under vacuum to afford 6-bromospiro[1H-indole-3,4'-oxahexan]-2-one (3.20 g, 98% yield), the product was a light pink solid. The product was detected by LRMS at m/z 278/280 (M-1)+. 1H-NMR (DMSO-d6) δ: 1.71 (m, 4H), 3.81 (m, 2H), 4.01 (m, 2H), 6.98 (d, J=1.65 Hz, 1H), 7.14 (dd, J=7.97 Hz, J=1.65 Hz, 1H). 7.47 (d, J=7.97Hz, 1H), 10.55 (s, NH). | | References | [1] Patent: EP2108641, 2009, A1. Location in patent: Page/Page column 32-33
[2] Patent: EP2113503, 2009, A1. Location in patent: Page/Page column 24 |
| | 6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one Preparation Products And Raw materials |
|