- DTBSF
-
- $15.00 / 1KG
-
2021-07-13
- CAS:393841-81-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2'-broMo-2,7-di-tert-butyl-9,9'-spirobi[fluorene] Basic information |
| Product Name: | 2'-broMo-2,7-di-tert-butyl-9,9'-spirobi[fluorene] | | Synonyms: | 2'-broMo-2,7-di-tert-butyl-9,9'-spirobi[fluorene];9,9'-Spirobi[9H-fluorene], 2'-bromo-2,7-bis(1,1-dimethylethyl)-;DTBSF;2′-Bromo-2,7-di-tert-butyl-9,9′-spirobi[9H-fluorene];2′-Bromo-2,7-bis(1,1-dimethylethyl)-9,9′-spirobi[9H-fluorene];2-bromo-2',7'-ditert-butyl-9,9'-spirobi[fluorene];2'-Bromo-2,7-bis(1,1-dimethylethyl)-9,9'-Spirobi[9H-fluorene];2'-broMo-2,7-di-tert-butyl-9,9'- | | CAS: | 393841-81-1 | | MF: | C33H31Br | | MW: | 507.5 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 393841-81-1.mol | ![2'-broMo-2,7-di-tert-butyl-9,9'-spirobi[fluorene] Structure](CAS/GIF/393841-81-1.gif) |
| | 2'-broMo-2,7-di-tert-butyl-9,9'-spirobi[fluorene] Chemical Properties |
| Melting point | 227 °C | | Boiling point | 549.9±29.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C33H31Br/c1-31(2,3)20-11-14-24-25-15-12-21(32(4,5)6)18-29(25)33(28(24)17-20)27-10-8-7-9-23(27)26-16-13-22(34)19-30(26)33/h7-19H,1-6H3 | | InChIKey | BBKNCZFSPQICQT-UHFFFAOYSA-N | | SMILES | C12(C3=C(C=CC=C3)C3=C1C=C(Br)C=C3)C1=C(C=CC(C(C)(C)C)=C1)C1=C2C=C(C(C)(C)C)C=C1 |
| | 2'-broMo-2,7-di-tert-butyl-9,9'-spirobi[fluorene] Usage And Synthesis |
| | 2'-broMo-2,7-di-tert-butyl-9,9'-spirobi[fluorene] Preparation Products And Raw materials |
|