|
|
| | N,N-Di(Methyl-d3)Methan-d3-aMine N-Oxide Basic information |
| | N,N-Di(Methyl-d3)Methan-d3-aMine N-Oxide Chemical Properties |
| Melting point | 236-238oC | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Light Sensitive | | InChI | InChI=1S/C3H9NO/c1-4(2,3)5/h1-3H3/i1D3,2D3,3D3 | | InChIKey | UYPYRKYUKCHHIB-GQALSZNTSA-N | | SMILES | N(=O)(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] | | CAS Number Unlabeled | 1184-78-7 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N,N-Di(Methyl-d3)Methan-d3-aMine N-Oxide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | (Trimethylamine-d9 N-Oxide) Labelled Trimethylamine N-Oxide, a potential osmolyte biomarker used in the measurement of marine osmolytes in mammalian serum. |
| | N,N-Di(Methyl-d3)Methan-d3-aMine N-Oxide Preparation Products And Raw materials |
|