| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | tert-Butyl N-(1,1-dioxothian-4-yl)carbaMate Basic information |
| Product Name: | tert-Butyl N-(1,1-dioxothian-4-yl)carbaMate | | Synonyms: | 1,1-Dimethylethyl (1,1-dioxido-tetrahydro-2H-thiopyran-4-yl)carbamate;tert-Butyl (1,1-dioxotetrahydro-2H-thiopyran-4-yl)carbamate;tert-butyl (1,1-dioxidotetrahydro-2H-thiopyran-4-yl)carbamate;tert-Butyl N-(1,1-dioxothian-4-yl)carbaMate;1,1-Dimethylethyl?N-(tetrahydro-1,1-dioxido-2H-thiopyran-4-yl)carbamate;Carbamic acid, N-(tetrahydro-1,1-dioxido-2H-thiopyran-4-yl)-, 1,1-dimethylethyl ester;tert-Butyl N-(1,1-dioxothian-4-yl)carbamate | | CAS: | 595597-01-6 | | MF: | C10H19NO4S | | MW: | 249.33 | | EINECS: | | | Product Categories: | | | Mol File: | 595597-01-6.mol |  |
| | tert-Butyl N-(1,1-dioxothian-4-yl)carbaMate Chemical Properties |
| Boiling point | 435.0±34.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | form | solid | | pka | 11.78±0.20(Predicted) | | InChI | 1S/C10H19NO4S/c1-10(2,3)15-9(12)11-8-4-6-16(13,14)7-5-8/h8H,4-7H2,1-3H3,(H,11,12) | | InChIKey | XKAPOJQKLRKFFV-UHFFFAOYSA-N | | SMILES | O=S1(CCC(NC(OC(C)(C)C)=O)CC1)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | tert-Butyl N-(1,1-dioxothian-4-yl)carbaMate Usage And Synthesis |
| | tert-Butyl N-(1,1-dioxothian-4-yl)carbaMate Preparation Products And Raw materials |
|