Boc-3,4-dehydro-D-proline Methyl ester manufacturers
|
| | Boc-3,4-dehydro-D-proline Methyl ester Basic information | | Application |
| Product Name: | Boc-3,4-dehydro-D-proline Methyl ester | | Synonyms: | Boc-3,4-dehydro-D-proline Methyl ester;Methyl (R)-1-Boc-2,5-dihydro-1H-pyrrole-2-carboxylate;1H-Pyrrole-1,2-dicarboxylic acid, 2,5-dihydro-, 1-(1,1-dimethylethyl)2-methyl ester, (2R)-;1-tert-butyl 2-methyl (2R)-2,5-dihydro-1H-pyrrole-1,2-dicarboxylate;1-(tert-Butyl) 2-methyl (R)-2,5-dihydro-1H-pyrrole-1,2-dicarboxylate;（2R）-N-Boc-3,4-dehydro-L-proline methyl ester;O1-tert-butyl O2-methyl (2R)-2,5-dihydropyrrole-1,2-dicarboxylate;N-Boc-3,4-dehydro-D-proline methyl ester | | CAS: | 220652-51-7 | | MF: | C11H17NO4 | | MW: | 227.26 | | EINECS: | | | Product Categories: | | | Mol File: | 220652-51-7.mol |  |
| | Boc-3,4-dehydro-D-proline Methyl ester Chemical Properties |
| Boiling point | 287.3±40.0 °C(Predicted) | | density | 1.148±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -3.53±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C11H17NO4/c1-11(2,3)16-10(14)12-7-5-6-8(12)9(13)15-4/h5-6,8H,7H2,1-4H3/t8-/m1/s1 | | InChIKey | YDQDZLXTPXNOKO-MRVPVSSYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC=C[C@@H]1C(OC)=O |
| | Boc-3,4-dehydro-D-proline Methyl ester Usage And Synthesis |
| Application | BOC-3,4-dehydro-D-proline methyl ester can be used as an organic synthesis intermediate and a pharmaceutical intermediate in laboratory research and development processes and in the synthesis of pharmaceutical chemicals. |
| | Boc-3,4-dehydro-D-proline Methyl ester Preparation Products And Raw materials |
|