|
|
| | 3-Fluoro-4-desfluoro BicalutaMide Basic information |
| | 3-Fluoro-4-desfluoro BicalutaMide Chemical Properties |
| Melting point | 154-157℃ (ethyl acetate hexane ) | | Boiling point | 658.6±55.0 °C(Predicted) | | density | 1.52±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.45±0.29(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C18H14F4N2O4S/c1-17(26,10-29(27,28)14-4-2-3-12(19)7-14)16(25)24-13-6-5-11(9-23)15(8-13)18(20,21)22/h2-8,26H,10H2,1H3,(H,24,25) | | InChIKey | JNUHKUUHIXCACT-UHFFFAOYSA-N | | SMILES | C(NC1=CC=C(C#N)C(C(F)(F)F)=C1)(=O)C(O)(C)CS(C1=CC=CC(F)=C1)(=O)=O |
| Storage Class | 13 - Non Combustible Solids |
| | 3-Fluoro-4-desfluoro BicalutaMide Usage And Synthesis |
| Uses | (3-Fluoro-4-desfluoro Bicalutamide) Bicalutamide (B382000) impurity. Bicalutamide is a non-steroidal peripherally active antiandrogen. Used as an antiandrogen, antineoplastic (hormonal). | | Uses | 3-Fluorophenyl Bicalutamide (Bicalutamide USP Related Compound B) is a steroisomer of Bicalutamide (B382000), non-steroidal peripherally active anti-androgen. Used as an antiandrogen, antineoplastic (hormonal). |
| | 3-Fluoro-4-desfluoro BicalutaMide Preparation Products And Raw materials |
|