| Company Name: |
chengqiaotech.ltd Gold |
| Tel: |
0533-2196219; 13864320634 |
| Email: |
lijindu01@163.com |
- 3-Hydroxythiophenol
-
- $80.00
-
2026-08-25
- CAS:40248-84-8
- Min. Order: 10kg
- Purity: 0.99
- Supply Ability: 20tons
- 3-Hydroxythiophenol
-
-
2026-06-30
- CAS:40248-84-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 10000KGS
|
| | 3-Hydroxythiophenol Basic information |
| | 3-Hydroxythiophenol Chemical Properties |
| Melting point | 16-17 °C(lit.) | | Boiling point | 242-243 °C(lit.) | | density | 1.237 g/mL at 25 °C(lit.) | | refractive index | n20/D >1.6290(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid | | pka | 6.50±0.10(Predicted) | | color | Clear colorless to pale yellow | | Specific Gravity | 1.24 | | Sensitive | Stench | | InChI | InChI=1S/C6H6OS/c7-5-2-1-3-6(8)4-5/h1-4,7-8H | | InChIKey | DOFIAZGYBIBEGI-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC(S)=C1 | | LogP | 1.814 (est) | | CAS DataBase Reference | 40248-84-8(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36-36/37/38-20/21/22 | | Safety Statements | 26-36-7/9 | | RIDADR | UN 3334 | | WGK Germany | 3 | | Hazard Note | Irritant/Stench | | HazardClass | IRRITANT, AIR SENSITIVE, STENCH | | HS Code | 29309090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Dam. 1 Skin Sens. 1 |
| | 3-Hydroxythiophenol Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 3-mercaptophenol may be used in the synthesis of the following:
- 4-(3-hydroxyphenylthio)naphthalene-1,2-dione, which shows fluorosence emission
- [C6H4-1-(SPPh2)-3-(OPPh2)], a non-symmetric ligand which can combine with PdCl2 to form a pincer complex
| | General Description | 3-mercaptophenol coated cantilevers can be used as formaldehyde sensors since it is highly selective towards formaldehyde and can show highest downward deflection on coming in contact with it. |
| | 3-Hydroxythiophenol Preparation Products And Raw materials |
|