2-(4-Methylbenzoyl)benzoic acid manufacturers
- 2-(p-Toluoyl)benzoic acid
-
- $0.00 / 1kg
-
2026-02-03
- CAS:85-55-2
- Min. Order: 1kg
- Purity: 98.0%min HPLC
- Supply Ability: 20tons/month
|
| | 2-(4-Methylbenzoyl)benzoic acid Basic information |
| Product Name: | 2-(4-Methylbenzoyl)benzoic acid | | Synonyms: | 2-[(4-methylphenyl)-oxomethyl]benzoate;2-Carboxy-4'-methylbenzophenone;2-(4-methylbenzoyl)benzenecarboxylic acid (en);ORTHO-(PARA-TOLUOYL)-BENZOIC ACID;4-Methylbenzophenone-2'-carboxylic Acid
2-(4-Methylbenzoyl)benzoic Acid
p-Toluoyl-o-benzoic Acid;Benzoic acid, 2-(4-methylbenzoyl)-;Benzoic acid, o-(p-toluoyl)- (8CI);2-(4-methylbenzoyl)-benzoicaci | | CAS: | 85-55-2 | | MF: | C15H12O3 | | MW: | 240.25 | | EINECS: | 201-614-3 | | Product Categories: | | | Mol File: | 85-55-2.mol |  |
| | 2-(4-Methylbenzoyl)benzoic acid Chemical Properties |
| Melting point | 137-139 °C(lit.) | | Boiling point | 342.97°C (rough estimate) | | density | 1.1783 (rough estimate) | | refractive index | 1.5570 (estimate) | | storage temp. | Store below +30°C. | | solubility | very soluble in Benzene,Ether,Acetone,Alcohol | | pka | 3.33±0.36(Predicted) | | form | powder to crystal | | color | White to Almost white | | Merck | 14,9539 | | BRN | 2111078 | | InChI | InChI=1S/C15H12O3/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15(17)18/h2-9H,1H3,(H,17,18) | | InChIKey | ICQOWIXIHDDXDI-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1C(=O)C1=CC=C(C)C=C1 | | CAS DataBase Reference | 85-55-2(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 2-(4-methylbenzoyl)-(85-55-2) | | EPA Substance Registry System | Benzoic acid, 2-(4-methylbenzoyl)- (85-55-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2918300090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2-(4-Methylbenzoyl)benzoic acid Usage And Synthesis |
| Uses | 2-(4-Methylbenzoyl)benzoic acid is used as a reactant in the coupling of benzoic and phenylacetic acids with aryltrifluoroborates. |
| | 2-(4-Methylbenzoyl)benzoic acid Preparation Products And Raw materials |
|