| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 6-Chloro-2-fluoro-3-methoxybenzaldehyde Basic information | | Uses |
| | 6-Chloro-2-fluoro-3-methoxybenzaldehyde Chemical Properties |
| Melting point | 95-100℃ | | Boiling point | 264.9±35.0 °C(Predicted) | | density | 1.334±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | Sensitive | Air Sensitive | | InChI | InChI=1S/C8H6ClFO2/c1-12-7-3-2-6(9)5(4-11)8(7)10/h2-4H,1H3 | | InChIKey | OADUJQWBRPRPQX-UHFFFAOYSA-N | | SMILES | C(=O)C1=C(Cl)C=CC(OC)=C1F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2913000090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 6-Chloro-2-fluoro-3-methoxybenzaldehyde Usage And Synthesis |
| Uses | 6-Chloro-2-fluoro-3-methoxybenzaldehyde is a useful research chemical. | | Uses | Used as solvents. They are used in intermediate steps for the production of paints, plastics, synthetic resins, and dyes. They are also used in the manufacture of perfumes, solvents, and flavorings. |
| | 6-Chloro-2-fluoro-3-methoxybenzaldehyde Preparation Products And Raw materials |
|