| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Sulfobenzoic acid monopotassium salt manufacturers
|
| | 4-Sulfobenzoic acid monopotassium salt Basic information |
| | 4-Sulfobenzoic acid monopotassium salt Chemical Properties |
| storage temp. | 2-8°C, sealed storage, away from moisture | | Appearance | White to off-white Solid | | Sensitive | Hygroscopic | | InChI | 1S/C7H6O5S.K/c8-7(9)5-1-3-6(4-2-5)13(10,11)12;/h1-4H,(H,8,9)(H,10,11,12);/q;+1/p-1 | | InChIKey | PXRJBUPXKDXDLG-UHFFFAOYSA-M | | SMILES | [K+].OC(=O)c1ccc(cc1)S([O-])(=O)=O | | CAS DataBase Reference | 5399-63-3(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 4-sulfo-, monopotassium salt (5399-63-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29161900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Sulfobenzoic acid monopotassium salt Usage And Synthesis |
| Chemical Properties | WHITE FINE CRYSTALLINE POWDER | | Uses | Potassium 4-Carboxybenzenesulfonate is used as a reactant for the synthesis of Potassium and Rubidium Arenesulfonates which shows coordination behavior towards the anions. | | Uses | 4-Sulfobenzoic acid potassium salt was used as intercalating compound to improve clay exfoliation in the synthesis of poly(butylene terephthalate) (PBT) nanocomposites. |
| | 4-Sulfobenzoic acid monopotassium salt Preparation Products And Raw materials |
|