| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | PotassiuM 2-MethoxypyriMidine-5-trifluoroborate Basic information |
| Product Name: | PotassiuM 2-MethoxypyriMidine-5-trifluoroborate | | Synonyms: | Potassium 2-methoxypyrimidin-5-yl-5-trifluoroborate;potassium:trifluoro-(2-methoxypyrimidin-5-yl)boranuide;PotassiuM 2-MethoxypyriMidine-5-trifluoroborate;Potassium 2-methoxypyrimidin-5-yl-5-trifluoroborate 90%;Trifluoro(2-methoxypyrimidin-5-yl)borate | | CAS: | 1111732-99-0 | | MF: | C5H5BF3KN2O | | MW: | 216.01 | | EINECS: | | | Product Categories: | | | Mol File: | 1111732-99-0.mol |  |
| | PotassiuM 2-MethoxypyriMidine-5-trifluoroborate Chemical Properties |
| Melting point | 258-263 °C | | form | solid | | InChI | 1S/C5H5BF3N2O.K/c1-12-5-10-2-4(3-11-5)6(7,8)9;/h2-3H,1H3;/q-1;+1 | | InChIKey | ACPITJHSWGPRRF-UHFFFAOYSA-N | | SMILES | [K+].COc1ncc(cn1)[B-](F)(F)F |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-45-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | PotassiuM 2-MethoxypyriMidine-5-trifluoroborate Usage And Synthesis |
| Uses | Potassium 2-methoxypyrimidin-5-yl-5-trifluoroborate can be used as a substrate in:
- Metal-free synthesis of biaryls through oxidative electrocoupling reaction.
- Cross-coupling reactions with unactivated alkyl halides in the presence of a nickel catalyst.
- Suzuki-Miyaura coupling with aryl and heteroaryl halides using a palladium catalyst.
|
| | PotassiuM 2-MethoxypyriMidine-5-trifluoroborate Preparation Products And Raw materials |
|