|
|
| | 2-Methoxypyrimidine-5-boronic acid Basic information |
| | 2-Methoxypyrimidine-5-boronic acid Chemical Properties |
| Melting point | 161°C(lit.) | | Boiling point | 378.3±52.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 5.59±0.11(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C5H7BN2O3/c1-11-5-7-2-4(3-8-5)6(9)10/h2-3,9-10H,1H3 | | InChIKey | YPWAJLGHACDYQS-UHFFFAOYSA-N | | SMILES | B(C1=CN=C(OC)N=C1)(O)O | | CAS DataBase Reference | 628692-15-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36-41-36/37/38 | | Safety Statements | 26-39-36/37/39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 2-Methoxypyrimidine-5-boronic acid Usage And Synthesis |
| Chemical Properties | Off-white to light yellow solid | | Production Methods | 5-Bromo-2-methoxypyrimidine could synthesize 2-Methoxypyrimidine-5-boronic acid as the start material. |
| | 2-Methoxypyrimidine-5-boronic acid Preparation Products And Raw materials |
|