| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | HDMAPP - 1-Hydroxy-2-Methyl-2-buten-4-yl 4-diphosphate Basic information |
| Product Name: | HDMAPP - 1-Hydroxy-2-Methyl-2-buten-4-yl 4-diphosphate | | Synonyms: | (E)-1-Hydroxy-2-methyl-2-butenyl 4-pyrophosphate lithium salt;(E)-4-Hydroxy-3-methylbut-2-enyl diphosphate lithium salt;HDMAPP;HO-DMAPP;HDMAPP - 1-Hydroxy-2-Methyl-2-buten-4-yl 4-diphosphate;Diphosphoric acid, P-[(2E)-4-hydroxy-3-methyl-2-buten-1-yl] ester;1-Hydroxy-2-methyl-2-buten-4-yl 4-Diphosphate;[(4-hydroxy-3-methylbut-2-enoxy)-oxidophosphoryl] phosphate | | CAS: | 396726-03-7 | | MF: | C5H12O8P2 | | MW: | 262.09 | | EINECS: | | | Product Categories: | | | Mol File: | 396726-03-7.mol |  |
| | HDMAPP - 1-Hydroxy-2-Methyl-2-buten-4-yl 4-diphosphate Chemical Properties |
| storage temp. | -20°C | | form | solid | | InChI | 1S/C5H12O8P2/c1-5(4-6)2-3-12-15(10,11)13-14(7,8)9/h2,6H,3-4H2,1H3,(H,10,11)(H2,7,8,9)/p-3 | | InChIKey | MDSIZRKJVDMQOQ-UHFFFAOYSA-K | | SMILES | [P](=O)([O-])([O-])O[P](=O)([O-])OCC=C(CO)C |
| WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | HDMAPP - 1-Hydroxy-2-Methyl-2-buten-4-yl 4-diphosphate Usage And Synthesis |
| Uses | 1-Hydroxy-2-methyl-2-buten-4-yl 4-Diphosphate is an isoprenoid precursor produced by Plasmodium falciparum that affects A. gambiae s.l. blood meal seeking and feeding behaviours as well as susceptibility to infection. | | Biochem/physiol Actions | HMB-PP is an intermediate of the non-mevalonate pathway (MEP pathway) of isoprenoid biosynthesis; it was shown to be a potent γδ T cell activator. |
| | HDMAPP - 1-Hydroxy-2-Methyl-2-buten-4-yl 4-diphosphate Preparation Products And Raw materials |
|