CYM50308 manufacturers
- CYM50308
-
- $56.00
-
2026-05-26
- CAS:1345858-76-5
- Purity: 99.77%
- Supply Ability: 10g
|
| | CYM50308 Basic information |
| Product Name: | CYM50308 | | Synonyms: | CYM50308;(2Z,5Z)-5-[[1-(2,4-Difluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methylene]-2-[(2-methoxyethyl)imino]-3-methyl-4-thiazolidinone;4-Thiazolidinone, 5-[[1-(2,4-difluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methylene]-2-[(2-methoxyethyl)imino]-3-methyl-, (2Z,5Z)-;CYM50308,ML248,LPL Receptor,Lysophospholipid Receptor,CYM 50308,selective,S1P4-R,ML-248,receptor,Inhibitor,Potent,CYM-50308,inhibit,ML 248;(2Z,5Z)-5-{[1-(2,4-Difluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]me thylene}-2-[(2-methoxyethyl)imino]-3-methyl-1,3-thiazolidin-4-one;ML 248;ML248;ML-248 | | CAS: | 1345858-76-5 | | MF: | C20H21F2N3O2S | | MW: | 405.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1345858-76-5.mol |  |
| | CYM50308 Chemical Properties |
| Boiling point | 504.0±60.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 1 mg/ml | | form | A crystalline solid | | pka | 0.47±0.20(Predicted) | | color | Light yellow to yellow | | InChI | InChI=1S/C20H21F2N3O2S/c1-12-9-14(13(2)25(12)17-6-5-15(21)11-16(17)22)10-18-19(26)24(3)20(28-18)23-7-8-27-4/h5-6,9-11H,7-8H2,1-4H3/b18-10-,23-20- | | InChIKey | BKQZKTRCUAWRHT-ZGNGNRKCSA-N | | SMILES | S1/C(=C\C2C=C(C)N(C3=CC=C(F)C=C3F)C=2C)/C(=O)N(C)/C/1=N/CCOC |
| | CYM50308 Usage And Synthesis |
| Uses | CYM 50308 is a novel agonist of sphingosine-1-phosphate 4 receptor (S1P4). | | storage | Store at +4°C |
| | CYM50308 Preparation Products And Raw materials |
|