| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:beta-Alanine-13C3,15N
CAS:285978-07-6
Purity:99 atom % 13C, 98 atom % 15N Package:100MG Remarks:490822-100MG
|
| Company Name: |
Qingdao Tenglong microwave technology co., LTD.
|
| Tel: |
0532-83818797 18561885118 |
| Email: |
market@tlwb.com.cn |
| Products Intro: |
Product Name:BETA-ALANINE (13C3, 98%+; 15N, 96-99%)
CAS:285978-07-6
Purity:98% Package:0.25G Remarks:CNLM-3946-0.25
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:beta-Alanine-13C3,15N 99 atom % 13C, 98 atom % 15N
CAS:285978-07-6
Purity:99% (CP) Package:100mg Remarks:NULL
|
| Company Name: |
Reer Technology (Shanghai) Co., LTD
|
| Tel: |
021-64400900 15800436310 |
| Email: |
bessey@reertech.com |
| Products Intro: |
Product Name:BETA-ALANINE(13C3, 98%+; 15N, 96-99%)
CAS:285978-07-6
Purity:98% Package:0.25 G Remarks:CNLM-3946-0.25
|
|
| | BETA-ALANINE-13C3-15N Basic information |
| Product Name: | BETA-ALANINE-13C3-15N | | Synonyms: | BETA-ALANINE-13C3-15N;BETA-ALANINE-13C3-15N, 99 ATOM % 13C, 99 ATOM % 15N;3-aminopropionic acid-13c3,15n;β-alanine-13c3,15n;13C and 15N Labeled 3-aminopropionic acid;13C and 15N Labeled β-alanine;BETA-ALANINE (13C3, 98%+;[13C3,15N]--Alanine | | CAS: | 285978-07-6 | | MF: | C3H7NO2 | | MW: | 93.13 | | EINECS: | | | Product Categories: | | | Mol File: | 285978-07-6.mol |  |
| | BETA-ALANINE-13C3-15N Chemical Properties |
| Melting point | 205 °C (dec.)(lit.) | | storage temp. | -20°C Freezer | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6)/i1+1,2+1,3+1,4+1 | | InChIKey | UCMIRNVEIXFBKS-JCDJMFQYSA-N | | SMILES | [15NH2][13CH2][13CH2][13C](O)=O | | CAS Number Unlabeled | 107-95-9 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BETA-ALANINE-13C3-15N Usage And Synthesis |
| Uses | β-Alanine-13C3,15N is the isotope labeled analogue of β-Alanine (A637320), which is a naturally occurring beta amino acid. β-Alanine is formed in vivo by the degradation of Dihydro Uracil (D449990) and Carnosine. β-Alanine is also the rate-limiting precursor of Carnosine, as a result supplementation with β-Alanine increases the concentration of Carnosine in muscles. |
| | BETA-ALANINE-13C3-15N Preparation Products And Raw materials |
|