| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Chloro-2-fluorobenzotrifluoride Basic information |
| Product Name: | 5-Chloro-2-fluorobenzotrifluoride | | Synonyms: | 5-CHLORO-2-FLUORO(TRIFLUOROMETHYL)BENZENE;Benzene, 4-chloro-1-fluoro-2-(trifluoroMethyl)-;4-Chloro-1-fluoro-2-(trifluoromethyl)benzene, 5-Chloro-alpha,alpha,alpha,2-tetrafluorotoluene;5-Chloro-2-fluorobenzotrifluoride 98%;5-Chloro-2-fluorobenzotrifluoride, 98+%;5-Chloro-2-Fluorotrifluorotoluene;4-CHLORO-1-FLUORO-2-(TRIFLUOROMETHYL)BENZENE;5-Chloro-2-fluorobenzotrifluoride | | CAS: | 89634-74-2 | | MF: | C7H3ClF4 | | MW: | 198.55 | | EINECS: | | | Product Categories: | Miscellaneous | | Mol File: | 89634-74-2.mol |  |
| | 5-Chloro-2-fluorobenzotrifluoride Chemical Properties |
| Boiling point | 145℃ | | density | 1.43 | | refractive index | 1.437 | | Fp | 47°(117°F) | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C7H3ClF4/c8-4-1-2-6(9)5(3-4)7(10,11)12/h1-3H | | InChIKey | PFLGDQIWYTWKCM-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(Cl)C=C1C(F)(F)F | | CAS DataBase Reference | 89634-74-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HazardClass | 3 | | HS Code | 2903998090 |
| | 5-Chloro-2-fluorobenzotrifluoride Usage And Synthesis |
| | 5-Chloro-2-fluorobenzotrifluoride Preparation Products And Raw materials |
|