|
|
| | Methyl 4-bromo-2-fluoro-6-methylbenzoate Basic information |
| | Methyl 4-bromo-2-fluoro-6-methylbenzoate Chemical Properties |
| Boiling point | 284.3±40.0 °C(Predicted) | | density | 1.506±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C9H8BrFO2/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h3-4H,1-2H3 | | InChIKey | CGSQFHPDASRYOX-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=C(C)C=C(Br)C=C1F |
| | Methyl 4-bromo-2-fluoro-6-methylbenzoate Usage And Synthesis |
| Uses | Methyl 4-Bromo-2-fluoro-6-methylbenzoate is used in the synthesis of isoquinolones and dihydroazaindenone inhibitors of Mnk1 and Mnk2. | | Synthesis | Methyl 4-bromo-2-fluoro-6-methylbenzoate is a carboxylic acid ester organic substance, which can be prepared by reacting 4-bromo-2-fluoro-6-methylbenzoic acid with iodomethane. |
| | Methyl 4-bromo-2-fluoro-6-methylbenzoate Preparation Products And Raw materials |
|