| Company Name: |
Jalor-Chem co.,LTD |
| Tel: |
0510-0510-86396359 13382276200 |
| Email: |
sales@jalor-chem.com |
|
| | 4-Bromo-2-chloro-6-methyl-benzoic acid methyl ester Basic information |
| Product Name: | 4-Bromo-2-chloro-6-methyl-benzoic acid methyl ester | | Synonyms: | Benzoic acid, 4-broMo-2-chloro-6-Methyl-, Methyl ester;oMo-2-chloro-6-Methyl-Benzoic acid Methyl ester;4-Bromo-2-chloro-6-methyl-benzoic acid methyl ester;Methyl 2-methyl-4-bromo-6-chlorobenzoic acid;methyl 4-bromo-2-chloro-6-methylbenzoate | | CAS: | 877149-10-5 | | MF: | C9H8BrClO2 | | MW: | 263.52 | | EINECS: | | | Product Categories: | | | Mol File: | 877149-10-5.mol |  |
| | 4-Bromo-2-chloro-6-methyl-benzoic acid methyl ester Chemical Properties |
| Boiling point | 308.154±37.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.534±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to off-white Solid-liquid mixture | | InChI | InChI=1S/C9H8BrClO2/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h3-4H,1-2H3 | | InChIKey | KOVCJLYSMXZNDF-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=C(C)C=C(Br)C=C1Cl |
| | 4-Bromo-2-chloro-6-methyl-benzoic acid methyl ester Usage And Synthesis |
| Uses | Methyl 4-bromo-2-chloro-6-methylbenzoate is a useful organic building block. |
| | 4-Bromo-2-chloro-6-methyl-benzoic acid methyl ester Preparation Products And Raw materials |
|