|
|
| | Cyclotetrakis(1,4-butylene Terephthalate) Basic information |
| Product Name: | Cyclotetrakis(1,4-butylene Terephthalate) | | Synonyms: | PBT Impurity 3;cyclo-Tetrakis-tetramethylenterephthalat;Cyclotetrakis;Cyclotetrakis(1,4-butylene Terephthalate);3,8,12,17,21,26,30,35-octaoxa-1,10,19,28(1,4)-tetrabenzenacyclohexatriacontaphan-2,9,11,18,20,27,29,36-octaone;butyleneterephthalatecyclictetramer;Polybutylene Terephthalate Cyclic Tetramer (Cyclotetrakis(1,4-butylene Terephthalate));PBT4 | | CAS: | 29278-72-6 | | MF: | C48H48O16 | | MW: | 880.89 | | EINECS: | | | Product Categories: | | | Mol File: | 29278-72-6.mol |  |
| | Cyclotetrakis(1,4-butylene Terephthalate) Chemical Properties |
| Melting point | 244 - 246°C | | Boiling point | 1150.5±65.0 °C(Predicted) | | density | 1.208±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Acetonitrile (Slightly), Chloroform (Slightly) | | form | Solid | | color | White to Off-White | | InChIKey | NTPMAYBEVHHCEL-UHFFFAOYSA-N | | SMILES | C12C=CC(=CC=1)C(=O)OCCCCOC(=O)C1CCC(=C=C=1)C(=O)OCCCCOC(=O)C1CCC(=C=C=1)C(=O)OCCCCOC(=O)C1CCC(=C=C=1)C(=O)OCCCCOC2=O |
| | Cyclotetrakis(1,4-butylene Terephthalate) Usage And Synthesis |
| Uses | Cyclotetrakis(1,4-butylene terephthalate) is a cyclic trimer of poly(butylene terephthalate), a thermoplastic engineering polymer. |
| | Cyclotetrakis(1,4-butylene Terephthalate) Preparation Products And Raw materials |
|