| Company Name: |
Accela ChemBio Inc. |
| Tel: |
+1-858-6993322 +86-18019713315 |
| Email: |
info@accelachem.com |
| Products Intro: |
Product Name:3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluoro-1-decylamine
CAS:30670-30-5
Purity:>=97% Package:0.1g;0.25g;1g;5g;10g
|
|
|
|
|
| Company Name: |
Fuxin Pharmaceutical |
| Tel: |
+86-021-021-50872116 |
| Email: |
contact@fuxinpharm.com |
| Products Intro: |
Product Name:3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecan-1-amine
CAS:30670-30-5
Purity:0.98 Package:1kg; 25kg; or larger package as required Remarks:pharmaceutical intermediates；Chemical Intermediate
|
|
|
|
|
|
| | 1H,1H,2H,2H-PERFLUORODECYLAMINE Basic information |
| Product Name: | 1H,1H,2H,2H-PERFLUORODECYLAMINE | | Synonyms: | 2-(perfluoro-n-octyl)ethylamine;1H,1H,2H,2H-PERFLUORODECYLAMINE;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluoro-1-decylamine;1H,1H,2H,2H-Perfluorodecylamine99%;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecan-1-amine;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecylamine;2-(Perfluorooctyl)ethylamine;1H,1H,2H,2H-Heptadecafluorodecylamine 97% | | CAS: | 30670-30-5 | | MF: | C10H6F17N | | MW: | 463.13 | | EINECS: | | | Product Categories: | | | Mol File: | 30670-30-5.mol |  |
| | 1H,1H,2H,2H-PERFLUORODECYLAMINE Chemical Properties |
| Boiling point | 73 °C | | density | 1.595±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Ethanol (Slightly), Methanol (Slightly) | | pka | 8.56±0.10(Predicted) | | form | Oil | | color | Clear Colourless | | InChI | InChI=1S/C10H6F17N/c11-3(12,1-2-28)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h1-2,28H2 | | InChIKey | PFINVJYJNJHTFY-UHFFFAOYSA-N | | SMILES | C(N)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | 1H,1H,2H,2H-Perfluorodecylamine (30670-30-5) |
| | 1H,1H,2H,2H-PERFLUORODECYLAMINE Usage And Synthesis |
| Uses | 1H,1H,2H,2H-Perfluorodecylamine can be used as self-assembled monolayer (SAM) in organic LEDs |
| | 1H,1H,2H,2H-PERFLUORODECYLAMINE Preparation Products And Raw materials |
|