| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Pre-IBS Basic information |
| Product Name: | Pre-IBS | | Synonyms: | Potassium 2-iodo-5-methylbenzenesulfonate
;Pre-IBS;2-IODO-5-METHYLBENZENESULFONATE POTASSIUM;Potassium 2-iodo-5-methylbenzenesulfonateV | | CAS: | 1093215-92-9 | | MF: | C7H8IKO3S | | MW: | 338.2 | | EINECS: | | | Product Categories: | | | Mol File: | 1093215-92-9.mol |  |
| | Pre-IBS Chemical Properties |
| Melting point | 288-292°C | | storage temp. | 2-8°C | | form | powder | | InChI | 1S/C7H7IO3S.K/c1-5-2-3-6(8)7(4-5)12(9,10)11;/h2-4H,1H3,(H,9,10,11);/q;+1/p-1 | | InChIKey | LFQHEPUFDZVNHD-UHFFFAOYSA-M | | SMILES | [K+].Cc1ccc(I)c(c1)S([O-])(=O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Pre-IBS Usage And Synthesis |
| Uses | Catalyst for alcohol oxidation. | | Uses | - Catalyst for alcohol oxidation
| | General Description | This product has been enhanced for catalytic efficiency. | | reaction suitability | reagent type: oxidant |
| | Pre-IBS Preparation Products And Raw materials |
|