- 1,3-Diethylurea
-
-
2025-06-27
- CAS:623-76-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- 1,3-Diethylurea
-
-
2025-04-04
- CAS:623-76-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1Ton
- 1,3-Diethylurea
-
- $15.00
-
2021-07-13
- CAS:623-76-7
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | 1,3-Diethylurea Basic information |
| | 1,3-Diethylurea Chemical Properties |
| Melting point | 112-113 °C (lit.) | | Boiling point | 217.23°C (rough estimate) | | density | 1.0415 | | refractive index | 1.4616 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystaline | | pka | 16.53±0.46(Predicted) | | color | White to Almost white | | Water Solubility | Soluble in water. | | BRN | 1744741 | | InChI | InChI=1S/C5H12N2O/c1-3-6-5(8)7-4-2/h3-4H2,1-2H3,(H2,6,7,8) | | InChIKey | ZWAVGZYKJNOTPX-UHFFFAOYSA-N | | SMILES | N(CC)C(NCC)=O | | CAS DataBase Reference | 623-76-7(CAS DataBase Reference) | | NIST Chemistry Reference | Urea, N,N'-diethyl-(623-76-7) |
| | 1,3-Diethylurea Usage And Synthesis |
| Uses | N,N'-Diethylurea is used for synthesis of caffeine, theophylline, pharma chemicals, textile aids |
| | 1,3-Diethylurea Preparation Products And Raw materials |
|