|
|
| | Methyl benzethonium chloride Basic information |
| Product Name: | Methyl benzethonium chloride | | Synonyms: | ammoniium,benzyldimethyl(2-(2-(4-(1,1,3,3-tetramethylbutyl)tolyloxy)ethoxy)eth;benzenemethanaminium,n,n-dimethyl-n-[2-[2-[methyl-4-(1,1,3,3-tetramethylbutyl);delavan;N,N-Dimethyl-N-[2-[2-[3-methyl-4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]benzenemethanaminium·chloride;Methylbenzethonium chloride,N,N-Dimethyl-N-(2-[2-(methyl-4-[1,1,3,3-tetramethylbutyl]phenoxy)ethoxy]ethyl)benzylammonium chloride;Methylbenzethonium Chloride (500 mg);Methylbenzethonium Chloride (200 mg);N,N-DIMETHYL-N-[2-(2-[METHYL-4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY]ETHOXY)ETHYL]-BENZENEMETHANAMINIUM CHLORIDE | | CAS: | 25155-18-4 | | MF: | C28H44ClNO2 | | MW: | 462.11 | | EINECS: | 246-675-7 | | Product Categories: | Organics | | Mol File: | 25155-18-4.mol |  |
| | Methyl benzethonium chloride Chemical Properties |
| Melting point | 161-163 °C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Merck | 13,6051 | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | ANTISTATIC
DEODORANT
SURFACTANT - CLEANSING
ANTIMICROBIAL | | Cosmetic Ingredient Review (CIR) | METHYL BENZETHONIUM CHLORIDE (25155-18-4) | | InChI | InChI=1S/C28H44NO2.ClH/c1-23-20-25(14-15-26(23)28(5,6)22-27(2,3)4)31-19-18-30-17-16-29(7,8)21-24-12-10-9-11-13-24;/h9-15,20H,16-19,21-22H2,1-8H3;1H/q+1;/p-1 | | InChIKey | WYWSKWZUWZLELX-UHFFFAOYSA-M | | SMILES | C1(OCCOCC[N+](C)(C)CC2=CC=CC=C2)C=CC(C(C)(C)CC(C)(C)C)=C(C)C=1.[Cl-] | | CAS DataBase Reference | 25155-18-4(CAS DataBase Reference) | | EPA Substance Registry System | Methylbenzethonium chloride (25155-18-4) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-37/38-41 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | BO7380000 | | HS Code | 2923900100 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Skin Corr. 1C |
| | Methyl benzethonium chloride Usage And Synthesis |
| Chemical Properties | Colorless crystals; odorless; bitter taste.
Readily soluble in alcohol, hot benzene, “Cellosolve” [Union], chloroform, and water;
insoluble in carbon tetrachloride and ether. | | Uses | Anti-infective,topical. | | Uses | Methylbenzethonium Chloride is an anti-leishmanial agent, in the treatment of leishmaniasis, a zoonotic infection affecting people in tropical regions. | | Definition | A quaternary ammonium compound. | | Brand name | Delavan
(Bayer); Diaparene (Sterling Winthrop). | | Clinical Use | Benzyldimethyl[2-[2-[[4-(1,1,3,3-tetramethylbutyl)tolyl]oxy]ethoxy]ethyl]ammonium chloride (Diaparene) is amixture of methylated derivatives of methylbenzethoniumchloride. It is used specifically for the treatment of diaperrash in infants, caused by the yeast Candida albicans, whichproduces ammonia. The agent is also used as a general antiseptic.Its properties are virtually identical to those of benzethoniumchloride. |
| | Methyl benzethonium chloride Preparation Products And Raw materials |
|