| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | 1,6-Hexanebisphosphonic acid Basic information |
| Product Name: | 1,6-Hexanebisphosphonic acid | | Synonyms: | 1,6-HEXYLENEBISPHOSPHONIC ACID;1,6-Hexylenebisphosphonic acid, 98 %;1,6-HexylenediphosphonicAcid>;Phosphonic acid, P,P'-1,6-hexanediylbis-;1,6-Hexanediphosphonic Acid;(HBPA), 1,6-Hexanediphosphonic Acid;P,P′-1,6-Hexanediylbis[phosphonic acid;1,6-Hexylenediphosphonic Acid | | CAS: | 4721-22-6 | | MF: | C6H16O6P2 | | MW: | 246.14 | | EINECS: | | | Product Categories: | | | Mol File: | 4721-22-6.mol |  |
| | 1,6-Hexanebisphosphonic acid Chemical Properties |
| Melting point | 203.0 to 208.0 °C | | Boiling point | 533.6±60.0 °C(Predicted) | | density | 1.483±0.06 g/cm3(Predicted) | | pka | 2.33±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C6H16O6P2/c7-13(8,9)5-3-1-2-4-6-14(10,11)12/h1-6H2,(H2,7,8,9)(H2,10,11,12) | | InChIKey | WDYVUKGVKRZQNM-UHFFFAOYSA-N | | SMILES | C(CCCCCP(=O)(O)O)P(=O)(O)O |
| RIDADR | UN 3261 8/PG III | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2931499090 |
| | 1,6-Hexanebisphosphonic acid Usage And Synthesis |
| Uses | Hexane-1,6-diyldiphosphonic acid is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | IC 50 | Alkyl-Chain | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | 1,6-Hexanebisphosphonic acid Preparation Products And Raw materials |
|