| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
OTAVA chemicals |
| Tel: |
416 305 9979 (Canada) |
| Email: |
north.america@otavachemicals.com |
|
| | AURORA 16632 Basic information |
| Product Name: | AURORA 16632 | | Synonyms: | OTAVA-BB BB7013541208;AKOS BBS-00009022;OTAVA-BB 7013541208;{4-[(2-Methoxyanilino)carbonyl]phenoxy}acetic acid;2-{4-[(2-methoxyphenyl)carbamoyl]phenoxy}acetic acid;AURORA 16632;Acetic acid, 2-[4-[[(2-methoxyphenyl)amino]carbonyl]phenoxy]- | | CAS: | 462069-97-2 | | MF: | C16H15NO5 | | MW: | 301.29 | | EINECS: | | | Product Categories: | | | Mol File: | 462069-97-2.mol |  |
| | AURORA 16632 Chemical Properties |
| Boiling point | 431.7±35.0 °C(Predicted) | | density | 1.324±0.06 g/cm3(Predicted) | | pka | 3.04±0.10(Predicted) | | form | solid | | InChI | 1S/C16H15NO5/c1-21-14-5-3-2-4-13(14)17-16(20)11-6-8-12(9-7-11)22-10-15(18)19/h2-9H,10H2,1H3,(H,17,20)(H,18,19) | | InChIKey | YOXJRLFJWYEJRL-UHFFFAOYSA-N | | SMILES | N(c2c(cccc2)OC)C(=O)c1ccc(cc1)OCC(=O)O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | AURORA 16632 Usage And Synthesis |
| | AURORA 16632 Preparation Products And Raw materials |
|