| Company Name: |
Cochemical Ltd. Gold |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
2,6-Dibromo-4-fluorobenzaldehyde manufacturers
|
| | 2,6-Dibromo-4-fluorobenzaldehyde Basic information |
| | 2,6-Dibromo-4-fluorobenzaldehyde Chemical Properties |
| Melting point | 86.6-87.4 °C | | Boiling point | 277.8±35.0 °C(Predicted) | | density | 2.047±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H3Br2FO/c8-6-1-4(10)2-7(9)5(6)3-11/h1-3H | | InChIKey | ULSMYJACTJXCRB-UHFFFAOYSA-N | | SMILES | C(=O)C1=C(Br)C=C(F)C=C1Br |
| | 2,6-Dibromo-4-fluorobenzaldehyde Usage And Synthesis |
| | 2,6-Dibromo-4-fluorobenzaldehyde Preparation Products And Raw materials |
|