| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Tetrazine-PEG5-NHS ester manufacturers
|
| | Tetrazine-PEG5-NHS ester Basic information |
| Product Name: | Tetrazine-PEG5-NHS ester | | Synonyms: | Tetrazine-PEG5-NHS ester;Tetrazine-PEG5-NHS ester >=95%;Tetrazine-Ph-PEG5-NHS ester;4,7,10,13,16-Pentaoxa-20-azaheneicosanoic acid, 19-oxo-21-[4-(1,2,4,5-tetrazin-3-yl)phenyl]-, 2,5-dioxo-1-pyrrolidinyl ester;Tetrazine-PEG5-NHS;Tz-PEG5-NHS;2,5-dioxopyrrolidin-1-yl 1-({[4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl}carbamoyl)-3,6,9,12,15-pentaoxaoctadecan-18-oate;Tetrazine-PEG5-NHS Ester (CCT-1143) | | CAS: | 1682653-80-0 | | MF: | C27H36N6O10 | | MW: | 604.61 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1682653-80-0.mol |  |
| | Tetrazine-PEG5-NHS ester Chemical Properties |
| density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder or crystals | | pka | 14.28±0.46(Predicted) | | color | Purple to purplish red | | InChIKey | DUPHIQYIPUTDJS-UHFFFAOYSA-N | | SMILES | O=C(NCC1=CC=C(C2=NN=CN=N2)C=C1)CCOCCOCCOCCOCCOCCC(ON3C(CCC3=O)=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Tetrazine-PEG5-NHS ester Usage And Synthesis |
| Description | Tetrazine-PEG5-NHS Ester is a PEG linker containing a tetrazine group and an NHS ester which is very reactive with amine(NH2)-containing molecule. Methyltetrazine enable fast click reaction with TCO (trans-cycloctene). | | Uses | Tetrazine-PEG5-NHS ester (Tz-PEG5-NHS) can be used in click chemistry applications such as the preparation of chitosan-polyacrylamide microspheres utilizing selective tetrazine-trans-cyclooctene (Tz-TCO) ligation and the construction of copper-64 radiolabeled antibody by the click reaction. | | General Description | Tetrazine-PEG5-NHS ester has an N-hydroxysuccinimide (NHS) ester that can be reacted with primary amines and tetrazine, which is reactive to trans-cyclooctenes. Hydrogen substituted tetrazines demonstrate exceptionally fast kinetics, generally at least 10-fold faster compared to methyl substituted tetrazines. The aqueous solubility of this reagent is substantially enhanced by a hydrophilic polyethylene glycol (PEG) spacer arm. | | reaction suitability | reaction type: click chemistry
reagent type: linker | | IC 50 | PEGs; Alkyl/ether |
| | Tetrazine-PEG5-NHS ester Preparation Products And Raw materials |
|