|
|
| | trans-2,6-Dimethylpiperidin-4-one,N-BOCprotected Basic information |
| Product Name: | trans-2,6-Dimethylpiperidin-4-one,N-BOCprotected | | Synonyms: | trans-2,6-Dimethylpiperidin-4-one,N-BOCprotected;trans-2,6-Dimethyl-4-oxo-piperidine-1-carboxylic acid tert-butyl ester;N-Boc-trans-2,6-dimethyl-4-oxopiperidine;(2R,6R)-rel-tert-Butyl 2,6-dimethyl-4-oxopiperidine-1-carboxylate;1-Piperidinecarboxylic acid, 2,6-dimethyl-4-oxo-, 1,1-dimethylethyl ester, (2R,6R)-rel-;tert-butyl trans-2,6-dimethyl-4-oxo-piperidine-1-carboxylate - 97%;(2R,6R)-Rel-2,6-dimethyl-4-oxo-1,1-dimethylethyl Ester 1-Piperidine Carboxylic Acid;rel-tert-Butyl (2R,6R)-2,6-dimethyl-4-oxopiperidine-1-carboxylate | | CAS: | 184368-70-5 | | MF: | C12H21NO3 | | MW: | 227.3 | | EINECS: | | | Product Categories: | | | Mol File: | 184368-70-5.mol |  |
| | trans-2,6-Dimethylpiperidin-4-one,N-BOCprotected Chemical Properties |
| Boiling point | 308.2±35.0 °C(Predicted) | | density | 1.027±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -1.46±0.60(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1/C12H21NO3/c1-8-6-10(14)7-9(2)13(8)11(15)16-12(3,4)5/h8-9H,6-7H2,1-5H3/t8-,9-/s3 | | InChIKey | ADBYGASBXODWTQ-JQEWEITDNA-N | | SMILES | N1(C(OC(C)(C)C)=O)[C@H](C)CC(=O)C[C@H]1C |&1:8,14,r| |
| | trans-2,6-Dimethylpiperidin-4-one,N-BOCprotected Usage And Synthesis |
| Uses | (2R,6R)-Rel-2,6-dimethyl-4-oxo-1,1-dimethylethyl Ester 1-Piperidine Carboxylic Acid is a reagent in the preparation of some methylated analogs of isoguvacine derivatives which are potential GABAA agonists. |
| | trans-2,6-Dimethylpiperidin-4-one,N-BOCprotected Preparation Products And Raw materials |
|