| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | tert-Butyl trans-4-formylcyclohexylcarbamate Basic information |
| Product Name: | tert-Butyl trans-4-formylcyclohexylcarbamate | | Synonyms: | trans-Boc-4-aMinocyclohexanecarbaldehyde;tert-butyl (1r,4r)-4-forMylcyclohexylcarbaMate;trans-4-(Boc-aMino)cyclohexanecarboxaldehyde, 97%;trans-(4-Formyl-cyclohexyl)-carbamic acid tert-butyl ester;trans-tert-Butyl (4-formylcyclohexyl)carbamate;Carbamic acid, N-(trans-4-formylcyclohexyl)-,1,1-dimethylethyl ester;tert-Butyl (trans-4-formylcyclohexyl);Tert-Butyl Trans-4-Formylcyclohexylcarbamate≥ 99% (GC) | | CAS: | 181308-57-6 | | MF: | C12H21NO3 | | MW: | 227.3 | | EINECS: | | | Product Categories: | | | Mol File: | 181308-57-6.mol |  |
| | tert-Butyl trans-4-formylcyclohexylcarbamate Chemical Properties |
| Boiling point | 339.5±31.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | -20°C, stored under nitrogen | | pka | 12.33±0.40(Predicted) | | form | solid | | Appearance | White to off-white Solid | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C12H21NO3/c1-12(2,3)16-11(15)13-10-6-4-9(8-14)5-7-10/h8-10H,4-7H2,1-3H3,(H,13,15)/t9-,10- | | InChIKey | GPDBIGSFXXKWQR-MGCOHNPYSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CC[C@@H](C=O)CC1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | tert-Butyl trans-4-formylcyclohexylcarbamate Usage And Synthesis |
| Chemical Properties | White to light yellow solid | | Uses | trans-4-(Boc-amino)cyclohexanecarboxaldehyde is used as a intermediate in pharmaceutical. |
| | tert-Butyl trans-4-formylcyclohexylcarbamate Preparation Products And Raw materials |
|