| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-(4-Fluorophenyl)cyclohexane-1,3-dione Basic information |
| | 5-(4-Fluorophenyl)cyclohexane-1,3-dione Chemical Properties |
| Melting point | 186-189 °C(lit.) | | Boiling point | 353.8±42.0 °C(Predicted) | | density | 1.228±0.06 g/cm3(Predicted) | | pka | 4.90±0.20(Predicted) | | form | crystalline powder | | color | Yellow | | InChI | 1S/C12H11FO2/c13-10-3-1-8(2-4-10)9-5-11(14)7-12(15)6-9/h1-4,9H,5-7H2 | | InChIKey | LBTLJACXBCUFEF-UHFFFAOYSA-N | | SMILES | Fc1ccc(cc1)C2CC(=O)CC(=O)C2 | | CAS DataBase Reference | 55579-72-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2914790090 | | Storage Class | 11 - Combustible Solids |
| | 5-(4-Fluorophenyl)cyclohexane-1,3-dione Usage And Synthesis |
| Uses | 5-(4-Fluorophenyl)-1,3-cyclohexanedione is a cyclohexane-1,3-dione derivative. | | Definition | ChEBI: 5-(4-Fluorophenyl)cyclohexane-1,3-dione is an organofluorine compound. | | General Description | 5-(4-Fluorophenyl)-1,3-cyclohexanedione is a cyclohexane-1,3-dione derivative. |
| | 5-(4-Fluorophenyl)cyclohexane-1,3-dione Preparation Products And Raw materials |
|