| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | Sulfo-Cyanine5 carboxylic acid Basic information |
| Product Name: | Sulfo-Cyanine5 carboxylic acid | | Synonyms: | Sulfo-Cyanine5 carboxylic acid;Sulfo Cy5 Carboxylic acids(methyl);Sulfo-Cy5 carboxylic acid;diSulfo-Cyanine5 carboxylic acid;SULFOCY5CARBOXYLICACIDS;SulfoCy5Carboxylicacids, 95%;Sulfo-Cyanine5 Carboxylic Acid (Methyl Type);diSulfo-Cy5 carboxylic acid | | CAS: | 1121756-16-8 | | MF: | C32H38N2O8S2 | | MW: | 642.78 | | EINECS: | | | Product Categories: | Cyanine5 | | Mol File: | 1121756-16-8.mol |  |
| | Sulfo-Cyanine5 carboxylic acid Chemical Properties |
| solubility | Soluble in Water, DMSO, DMF, DCM | | Appearance | dark blue powder | | InChIKey | DTIFRUNGEJKSRN-UHFFFAOYSA-N | | SMILES | C(N1C(C(C)(C)C2=CC(S(O)(=O)=O)=CC=C12)=CC=CC=CC1=[N+](C2=CC=C(S([O-])(=O)=O)C=C2C1(C)C)C)CCCCC(=O)O |
| | Sulfo-Cyanine5 carboxylic acid Usage And Synthesis |
| Description | Cy5 dyes are one type of the most common red fluorophores. Its max. absorbance/emission max is 646/665nm. They are widely used for labeling peptides, proteins and oligos etc. for fluorescence imaging and other fluorescence-based biochemical analysis. | | Uses | Sulfo-Cy5 Carboxylic Acid can be used as reactant/reagent in preparation and identification of cyanine-dye labeled peptidic ligand for Y1R and Y4R, based upon the neuropeptide Y C-terminal analog BVD-15. | | Abs/Em Maxima | 646/662 nm | | Fluoresene quantum yield | 0.28 | | Extinction Coefficient | 271000 | | CF260 | 0.04 | | CF280 | 0.04 |
| | Sulfo-Cyanine5 carboxylic acid Preparation Products And Raw materials |
|