| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
(3R,5R)-3-(Boc-amino)-5-methylpiperidine manufacturers
|
| | (3R,5R)-3-(Boc-amino)-5-methylpiperidine Basic information |
| Product Name: | (3R,5R)-3-(Boc-amino)-5-methylpiperidine | | Synonyms: | (3R,5R)-3-(Boc-amino)-5-methylpiperidine;tert-Butyl((3R,5R)-5-methylpiperidin-3-yl)carbamate;tert-butyl N-[(3R,5R)-5-methylpiperidin-3-yl]carbamate;Carbamic acid, N-[(3R,5R)-5-methyl-3-piperidinyl]-, 1,1-dimethylethyl ester;3-Isoxazolecarboxylicacid,5-(8-methoxyphenyl)-;Methisosildenafil Impurity 45;Nemonoxacin Impurity 10;Nenofloxacin impurity 17 | | CAS: | 1227919-32-5 | | MF: | C11H22N2O2 | | MW: | 214.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1227919-32-5.mol |  |
| | (3R,5R)-3-(Boc-amino)-5-methylpiperidine Chemical Properties |
| Boiling point | 313.4±31.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 12.38±0.40(Predicted) | | InChI | InChI=1S/C11H22N2O2/c1-8-5-9(7-12-6-8)13-10(14)15-11(2,3)4/h8-9,12H,5-7H2,1-4H3,(H,13,14)/t8-,9-/m1/s1 | | InChIKey | CNALVHVMBXLLIY-RKDXNWHRSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1C[C@@H](C)CNC1 |
| | (3R,5R)-3-(Boc-amino)-5-methylpiperidine Usage And Synthesis |
| Uses | (3R,5R)-3-(Boc-amino)-5-methylpiperidine is used in the synthetic preparation of amino(aminopyrimidinyl)indazoles as selective 3-phosphoinositide-dependent kinase-1 inhibitors and antitumor agents. | | Synthesis | Step 1: tert-Butyl ((3R,5R)-1-benzyl-5-methylpiperidin-3-yl)carbamate (0.6 g, 1.971 mmol, see WO2004014893 for preparation) was dissolved in ethanol (10 mL) and palladium carbon (Pd(OH)2/C, 0.1 g) was added. The reaction mixture was stirred at room temperature and under an atmosphere of hydrogen at 1 atm. After 2 h, the palladium catalyst was removed by filtration and the solvent was subsequently evaporated to afford 0.45 g of tert-butyl ((3R,5R)-5-methylpiperidin-3-yl)carbamate as a colorless oil in >95% yield. | | References | [1] Patent: US2010/144745, 2010, A1. Location in patent: Page/Page column 44 [2] Patent: US2011/59118, 2011, A1. Location in patent: Page/Page column 53 [3] Journal of Medicinal Chemistry, 2011, vol. 54, # 6, p. 1871 - 1895 |
| | (3R,5R)-3-(Boc-amino)-5-methylpiperidine Preparation Products And Raw materials |
|