2,2-diethoxyacetic acid manufacturers
|
| | 2,2-diethoxyacetic acid Basic information |
| | 2,2-diethoxyacetic acid Chemical Properties |
| Boiling point | 108-110 °C(Press: 11 Torr) | | density | 1.095±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 2.43±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H12O4/c1-3-9-6(5(7)8)10-4-2/h6H,3-4H2,1-2H3,(H,7,8) | | InChIKey | WFVKIANRKSZMGB-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(OCC)OCC |
| | 2,2-diethoxyacetic acid Usage And Synthesis |
| | 2,2-diethoxyacetic acid Preparation Products And Raw materials |
|