| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Company Name: |
Jalor-Chem co.,LTD |
| Tel: |
0510-0510-86396359 13382276200 |
| Email: |
sales@jalor-chem.com |
|
| | 1,2-bis(chloranyl)-4-fluoranyl-3-nitro-benzene Basic information |
| | 1,2-bis(chloranyl)-4-fluoranyl-3-nitro-benzene Chemical Properties |
| Boiling point | 270.1±35.0 °C(Predicted) | | density | 1.622±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C6H2Cl2FNO2/c7-3-1-2-4(9)6(5(3)8)10(11)12/h1-2H | | InChIKey | ZPHVCFRWQIJBAZ-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(F)C([N+]([O-])=O)=C1Cl |
| | 1,2-bis(chloranyl)-4-fluoranyl-3-nitro-benzene Usage And Synthesis |
| | 1,2-bis(chloranyl)-4-fluoranyl-3-nitro-benzene Preparation Products And Raw materials |
|